C22H24N2O2S — CID 136843158
5-(3,4-dimethylphenyl)-4-methyl-1,1-dioxo-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]-1,2-thiazol-3-imine (PubChem CID 136843158) has the molecular formula C22H24N2O2S and a molecular weight of 380.51 g/mol. Its IUPAC name is 5-(3,4-dimethylphenyl)-4-methyl-1,1-dioxo-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]-1,2-thiazol-3-imine.
| Compound Name | 5-(3,4-dimethylphenyl)-4-methyl-1,1-dioxo-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]-1,2-thiazol-3-imine |
|---|---|
| PubChem CID | 136843158 |
| Molecular Formula | C22H24N2O2S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | 5-(3,4-dimethylphenyl)-4-methyl-1,1-dioxo-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]-1,2-thiazol-3-imine |
| SMILES | CC1=C(c2ccc(C)c(C)c2)S(=O)(=O)N/C1=N\[C@H]1CCCc2ccccc21 |
| InChI | InChI=1S/C22H24N2O2S/c1-14-11-12-18(13-15(14)2)21-16(3)22(24-27(21,25)26)23-20-10-6-8-17-7-4-5-9-19(17)20/h4-5,7,9,11-13,20H,6,8,10H2,1-3H3,(H,23,24)/t20-/m0/s1 |
| InChIKey | IJFPNIHFUSKJIQ-FQEVSTJZSA-N |
| XLogP | 4.44 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|