C17H24N2OS — CID 90847935
ethane;1-[2-(1,2,3,4-tetrahydronaphthalen-1-ylimino)-1,3-thiazolidin-3-yl]ethanone (PubChem CID 90847935) has the molecular formula C17H24N2OS and a molecular weight of 304.46 g/mol. Its IUPAC name is ethane;1-[2-(1,2,3,4-tetrahydronaphthalen-1-ylimino)-1,3-thiazolidin-3-yl]ethanone.
| Compound Name | ethane;1-[2-(1,2,3,4-tetrahydronaphthalen-1-ylimino)-1,3-thiazolidin-3-yl]ethanone |
|---|---|
| PubChem CID | 90847935 |
| Molecular Formula | C17H24N2OS |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | ethane;1-[2-(1,2,3,4-tetrahydronaphthalen-1-ylimino)-1,3-thiazolidin-3-yl]ethanone |
| SMILES | CC.CC(=O)N1CCS/C1=N\C1CCCc2ccccc21 |
| InChI | InChI=1S/C15H18N2OS.C2H6/c1-11(18)17-9-10-19-15(17)16-14-8-4-6-12-5-2-3-7-13(12)14;1-2/h2-3,5,7,14H,4,6,8-10H2,1H3;1-2H3/b16-15-; |
| InChIKey | FCLMOQVKQYSBBO-YFKNTREVSA-N |
| XLogP | 4.04 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|