C20H12N4O3 — CID 136843960
2-hydroxy-5-(1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl)benzoic acid (PubChem CID 136843960) has the molecular formula C20H12N4O3 and a molecular weight of 356.34 g/mol. Its IUPAC name is 2-hydroxy-5-(1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl)benzoic acid.
| Compound Name | 2-hydroxy-5-(1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl)benzoic acid |
|---|---|
| PubChem CID | 136843960 |
| Molecular Formula | C20H12N4O3 |
| Molecular Weight | 356.34 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | 2-hydroxy-5-(1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl)benzoic acid |
| SMILES | O=C(O)c1cc(-c2nc3c4cccnc4c4ncccc4c3[nH]2)ccc1O |
| InChI | InChI=1S/C20H12N4O3/c25-14-6-5-10(9-13(14)20(26)27)19-23-17-11-3-1-7-21-15(11)16-12(18(17)24-19)4-2-8-22-16/h1-9,25H,(H,23,24)(H,26,27) |
| InChIKey | HIELNBSUARCBLP-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 111.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.34 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|