C14H17ClN4O — CID 136854091
(5S,7S)-7-(4-chlorophenyl)-2-(methoxymethyl)-5-methyl-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine (PubChem CID 136854091) has the molecular formula C14H17ClN4O and a molecular weight of 292.77 g/mol. Its IUPAC name is (5S,7S)-7-(4-chlorophenyl)-2-(methoxymethyl)-5-methyl-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine.
| Compound Name | (5S,7S)-7-(4-chlorophenyl)-2-(methoxymethyl)-5-methyl-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 136854091 |
| Molecular Formula | C14H17ClN4O |
| Molecular Weight | 292.77 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | (5S,7S)-7-(4-chlorophenyl)-2-(methoxymethyl)-5-methyl-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine |
| SMILES | COCc1nc2n(n1)[C@H](c1ccc(Cl)cc1)C[C@H](C)N2 |
| InChI | InChI=1S/C14H17ClN4O/c1-9-7-12(10-3-5-11(15)6-4-10)19-14(16-9)17-13(18-19)8-20-2/h3-6,9,12H,7-8H2,1-2H3,(H,16,17,18)/t9-,12-/m0/s1 |
| InChIKey | PXDKMHJDSBQKBB-CABZTGNLSA-N |
| XLogP | 2.87 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.77 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |