C18H15N3O6S — CID 136855869
8-[(5-ethyl-2-nitrophenyl)diazenyl]-7-hydroxynaphthalene-1-sulfonic acid (PubChem CID 136855869) has the molecular formula C18H15N3O6S and a molecular weight of 401.40 g/mol. Its IUPAC name is 8-[(5-ethyl-2-nitrophenyl)diazenyl]-7-hydroxynaphthalene-1-sulfonic acid.
| Compound Name | 8-[(5-ethyl-2-nitrophenyl)diazenyl]-7-hydroxynaphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 136855869 |
| Molecular Formula | C18H15N3O6S |
| Molecular Weight | 401.40 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | 8-[(5-ethyl-2-nitrophenyl)diazenyl]-7-hydroxynaphthalene-1-sulfonic acid |
| SMILES | CCc1ccc([N+](=O)[O-])c(/N=N/c2c(O)ccc3cccc(S(=O)(=O)O)c23)c1 |
| InChI | InChI=1S/C18H15N3O6S/c1-2-11-6-8-14(21(23)24)13(10-11)19-20-18-15(22)9-7-12-4-3-5-16(17(12)18)28(25,26)27/h3-10,22H,2H2,1H3,(H,25,26,27)/b20-19+ |
| InChIKey | VXGSYMXUYBTVES-FMQUCBEESA-N |
| XLogP | 4.68 |
| TPSA | 142.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.40 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|