C36H30BaN6O12S2+2 — CID 136855953
barium(2+);bis(5-[[4-ethyl-2-[hydroxy(oxo)azaniumyl]phenyl]diazenyl]-6-hydroxynaphthalene-1-sulfonate) (PubChem CID 136855953) has the molecular formula C36H30BaN6O12S2+2 and a molecular weight of 940.13 g/mol. Its IUPAC name is barium(2+);bis(5-[[4-ethyl-2-[hydroxy(oxo)azaniumyl]phenyl]diazenyl]-6-hydroxynaphthalene-1-sulfonate).
| Compound Name | barium(2+);bis(5-[[4-ethyl-2-[hydroxy(oxo)azaniumyl]phenyl]diazenyl]-6-hydroxynaphthalene-1-sulfonate) |
|---|---|
| PubChem CID | 136855953 |
| Molecular Formula | C36H30BaN6O12S2+2 |
| Molecular Weight | 940.13 g/mol |
| Exact Mass | 940.04 |
| IUPAC Name | barium(2+);bis(5-[[4-ethyl-2-[hydroxy(oxo)azaniumyl]phenyl]diazenyl]-6-hydroxynaphthalene-1-sulfonate) |
| SMILES | CCc1ccc(/N=N/c2c(O)ccc3c(S(=O)(=O)[O-])cccc23)c([N+](=O)O)c1.CCc1ccc(/N=N/c2c(O)ccc3c(S(=O)(=O)[O-])cccc23)c([N+](=O)O)c1.[Ba+2] |
| InChI | InChI=1S/2C18H15N3O6S.Ba/c2*1-2-11-6-8-14(15(10-11)21(23)24)19-20-18-13-4-3-5-17(28(25,26)27)12(13)7-9-16(18)22;/h2*3-10H,2H2,1H3,(H2-,19,22,23,24,25,26,27);/q;;+2 |
| InChIKey | GPFYUDVOWFNKGG-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 284.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 940.13 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|