C34H33NO4S — CID 136857614
2-tert-butyl-5-[(4-tert-butyl-3,6-dioxocyclohexa-1,4-dien-1-yl)-[4-[(4-sulfanylphenyl)methylideneamino]phenyl]methyl]cyclohexa-2,5-diene-1,4-dione (PubChem CID 136857614) has the molecular formula C34H33NO4S and a molecular weight of 551.71 g/mol. Its IUPAC name is 2-tert-butyl-5-[(4-tert-butyl-3,6-dioxocyclohexa-1,4-dien-1-yl)-[4-[(4-sulfanylphenyl)methylideneamino]phenyl]methyl]cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-tert-butyl-5-[(4-tert-butyl-3,6-dioxocyclohexa-1,4-dien-1-yl)-[4-[(4-sulfanylphenyl)methylideneamino]phenyl]methyl]cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 136857614 |
| Molecular Formula | C34H33NO4S |
| Molecular Weight | 551.71 g/mol |
| Exact Mass | 551.21 |
| IUPAC Name | 2-tert-butyl-5-[(4-tert-butyl-3,6-dioxocyclohexa-1,4-dien-1-yl)-[4-[(4-sulfanylphenyl)methylideneamino]phenyl]methyl]cyclohexa-2,5-diene-1,4-dione |
| SMILES | CC(C)(C)C1=CC(=O)C(C(C2=CC(=O)C(C(C)(C)C)=CC2=O)c2ccc(/N=C/c3ccc(S)cc3)cc2)=CC1=O |
| InChI | InChI=1S/C34H33NO4S/c1-33(2,3)26-17-28(36)24(15-30(26)38)32(25-16-31(39)27(18-29(25)37)34(4,5)6)21-9-11-22(12-10-21)35-19-20-7-13-23(40)14-8-20/h7-19,32,40H,1-6H3/b35-19+ |
| InChIKey | HPZIHVXUTJWXLE-XZYGTATASA-N |
| XLogP | 6.91 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.71 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|