C13H15N3Se — CID 136861254
1-(1H-imidazol-2-yl)-N-(3-phenylselanylpropyl)methanimine (PubChem CID 136861254) has the molecular formula C13H15N3Se and a molecular weight of 292.24 g/mol. Its IUPAC name is 1-(1H-imidazol-2-yl)-N-(3-phenylselanylpropyl)methanimine.
| Compound Name | 1-(1H-imidazol-2-yl)-N-(3-phenylselanylpropyl)methanimine |
|---|---|
| PubChem CID | 136861254 |
| Molecular Formula | C13H15N3Se |
| Molecular Weight | 292.24 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | 1-(1H-imidazol-2-yl)-N-(3-phenylselanylpropyl)methanimine |
| SMILES | C(=N/CCC[Se]c1ccccc1)\c1ncc[nH]1 |
| InChI | InChI=1S/C13H15N3Se/c1-2-5-12(6-3-1)17-10-4-7-14-11-13-15-8-9-16-13/h1-3,5-6,8-9,11H,4,7,10H2,(H,15,16)/b14-11+ |
| InChIKey | AYAPXSBDDAUYAI-SDNWHVSQSA-N |
| XLogP | 1.67 |
| TPSA | 41.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.24 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|