C9H15N5OS — CID 136863160
N'-hydroxy-5-[methyl(2-methylsulfanylethyl)amino]pyrazine-2-carboximidamide (PubChem CID 136863160) has the molecular formula C9H15N5OS and a molecular weight of 241.32 g/mol. Its IUPAC name is N'-hydroxy-5-[methyl(2-methylsulfanylethyl)amino]pyrazine-2-carboximidamide.
| Compound Name | N'-hydroxy-5-[methyl(2-methylsulfanylethyl)amino]pyrazine-2-carboximidamide |
|---|---|
| PubChem CID | 136863160 |
| Molecular Formula | C9H15N5OS |
| Molecular Weight | 241.32 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | N'-hydroxy-5-[methyl(2-methylsulfanylethyl)amino]pyrazine-2-carboximidamide |
| SMILES | CSCCN(C)c1cnc(C(N)=NO)cn1 |
| InChI | InChI=1S/C9H15N5OS/c1-14(3-4-16-2)8-6-11-7(5-12-8)9(10)13-15/h5-6,15H,3-4H2,1-2H3,(H2,10,13) |
| InChIKey | UKCAHIFXUVSJJY-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.32 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|