About N-[(Z)-(2,4-dihydroxyphenyl)methylideneamino]nonane-1-sulfonamide
N-[(Z)-(2,4-dihydroxyphenyl)methylideneamino]nonane-1-sulfonamide (PubChem CID 136863910) has the molecular formula C16H26N2O4S
and a molecular weight of 342.46 g/mol. Its IUPAC name is N-[(Z)-(2,4-dihydroxyphenyl)methylideneamino]nonane-1-sulfonamide.
Molecular Properties
| Compound Name | N-[(Z)-(2,4-dihydroxyphenyl)methylideneamino]nonane-1-sulfonamide |
| PubChem CID | 136863910 |
| Molecular Formula | C16H26N2O4S |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | N-[(Z)-(2,4-dihydroxyphenyl)methylideneamino]nonane-1-sulfonamide |
| SMILES | CCCCCCCCCS(=O)(=O)N/N=C\c1ccc(O)cc1O |
| InChI | InChI=1S/C16H26N2O4S/c1-2-3-4-5-6-7-8-11-23(21,22)18-17-13-14-9-10-15(19)12-16(14)20/h9-10,12-13,18-20H,2-8,11H2,1H3/b17-13- |
| InChIKey | ZMKBJRXMRXRIAB-LGMDPLHJSA-N |
| XLogP | 3.10 |
| TPSA | 98.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(Z)-(2,4-dihydroxyphenyl)methylideneamino]nonane-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z)-(2,4-dihydroxyphenyl)methylideneamino]nonane-1-sulfonamide?
The IUPAC name of N-[(Z)-(2,4-dihydroxyphenyl)methylideneamino]nonane-1-sulfonamide (CID 136863910) is N-[(Z)-(2,4-dihydroxyphenyl)methylideneamino]nonane-1-sulfonamide.
What is the SMILES notation for N-[(Z)-(2,4-dihydroxyphenyl)methylideneamino]nonane-1-sulfonamide?
The canonical SMILES for N-[(Z)-(2,4-dihydroxyphenyl)methylideneamino]nonane-1-sulfonamide is CCCCCCCCCS(=O)(=O)N/N=C\c1ccc(O)cc1O.
What is the InChIKey of N-[(Z)-(2,4-dihydroxyphenyl)methylideneamino]nonane-1-sulfonamide?
The InChIKey is ZMKBJRXMRXRIAB-LGMDPLHJSA-N. The full InChI is InChI=1S/C16H26N2O4S/c1-2-3-4-5-6-7-8-11-23(21,22)18-17-13-14-9-10-15(19)12-16(14)20/h9-10,12-13,18-20H,2-8,11H2,1H3/b17-13-.
What are the key properties of N-[(Z)-(2,4-dihydroxyphenyl)methylideneamino]nonane-1-sulfonamide?
N-[(Z)-(2,4-dihydroxyphenyl)methylideneamino]nonane-1-sulfonamide has a molecular weight of 342.46 g/mol, XLogP of 3.10, 11 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z)-(2,4-dihydroxyphenyl)methylideneamino]nonane-1-sulfonamide is sourced from PubChem (CID 136863910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).