C20H22N4O5S — CID 136863967
(3R)-3-[[4-(methoxymethyl)-6-oxo-1H-pyrimidin-2-yl]sulfanyl]-1-(4-morpholin-4-ylphenyl)pyrrolidine-2,5-dione (PubChem CID 136863967) has the molecular formula C20H22N4O5S and a molecular weight of 430.49 g/mol. Its IUPAC name is (3R)-3-[[4-(methoxymethyl)-6-oxo-1H-pyrimidin-2-yl]sulfanyl]-1-(4-morpholin-4-ylphenyl)pyrrolidine-2,5-dione.
| Compound Name | (3R)-3-[[4-(methoxymethyl)-6-oxo-1H-pyrimidin-2-yl]sulfanyl]-1-(4-morpholin-4-ylphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 136863967 |
| Molecular Formula | C20H22N4O5S |
| Molecular Weight | 430.49 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | (3R)-3-[[4-(methoxymethyl)-6-oxo-1H-pyrimidin-2-yl]sulfanyl]-1-(4-morpholin-4-ylphenyl)pyrrolidine-2,5-dione |
| SMILES | COCc1cc(=O)[nH]c(S[C@@H]2CC(=O)N(c3ccc(N4CCOCC4)cc3)C2=O)n1 |
| InChI | InChI=1S/C20H22N4O5S/c1-28-12-13-10-17(25)22-20(21-13)30-16-11-18(26)24(19(16)27)15-4-2-14(3-5-15)23-6-8-29-9-7-23/h2-5,10,16H,6-9,11-12H2,1H3,(H,21,22,25)/t16-/m1/s1 |
| InChIKey | FINFZXHAQRJYFO-MRXNPFEDSA-N |
| XLogP | 1.18 |
| TPSA | 104.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.49 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|