C15H10BrF2N3O — CID 136867814
3-[(4-bromo-3-methylphenyl)diazenyl]-5,7-difluoro-1H-indol-2-ol (PubChem CID 136867814) has the molecular formula C15H10BrF2N3O and a molecular weight of 366.17 g/mol. Its IUPAC name is 3-[(4-bromo-3-methylphenyl)diazenyl]-5,7-difluoro-1H-indol-2-ol.
| Compound Name | 3-[(4-bromo-3-methylphenyl)diazenyl]-5,7-difluoro-1H-indol-2-ol |
|---|---|
| PubChem CID | 136867814 |
| Molecular Formula | C15H10BrF2N3O |
| Molecular Weight | 366.17 g/mol |
| Exact Mass | 365.00 |
| IUPAC Name | 3-[(4-bromo-3-methylphenyl)diazenyl]-5,7-difluoro-1H-indol-2-ol |
| SMILES | Cc1cc(/N=N/c2c(O)[nH]c3c(F)cc(F)cc23)ccc1Br |
| InChI | InChI=1S/C15H10BrF2N3O/c1-7-4-9(2-3-11(7)16)20-21-14-10-5-8(17)6-12(18)13(10)19-15(14)22/h2-6,19,22H,1H3/b21-20+ |
| InChIKey | ZYIHFMSUNASVCK-QZQOTICOSA-N |
| XLogP | 5.64 |
| TPSA | 60.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.17 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|