C12H11F2N3O2 — CID 136867834
N-[(5,7-difluoro-2-hydroxy-1H-indol-3-yl)imino]-2-methylpropanamide (PubChem CID 136867834) has the molecular formula C12H11F2N3O2 and a molecular weight of 267.24 g/mol. Its IUPAC name is N-[(5,7-difluoro-2-hydroxy-1H-indol-3-yl)imino]-2-methylpropanamide.
| Compound Name | N-[(5,7-difluoro-2-hydroxy-1H-indol-3-yl)imino]-2-methylpropanamide |
|---|---|
| PubChem CID | 136867834 |
| Molecular Formula | C12H11F2N3O2 |
| Molecular Weight | 267.24 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | N-[(5,7-difluoro-2-hydroxy-1H-indol-3-yl)imino]-2-methylpropanamide |
| SMILES | CC(C)C(=O)/N=N/c1c(O)[nH]c2c(F)cc(F)cc12 |
| InChI | InChI=1S/C12H11F2N3O2/c1-5(2)11(18)17-16-10-7-3-6(13)4-8(14)9(7)15-12(10)19/h3-5,15,19H,1-2H3/b17-16+ |
| InChIKey | QWXGVCZEEOWHOH-WUKNDPDISA-N |
| XLogP | 3.42 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.24 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|