C25H18F2N6O3 — CID 166205930
3-[(7-fluoro-2-hydroxy-5-methyl-1H-indol-3-yl)diazenyl]-N-[(7-fluoro-2-hydroxy-5-methyl-1H-indol-3-yl)imino]benzamide (PubChem CID 166205930) has the molecular formula C25H18F2N6O3 and a molecular weight of 488.45 g/mol. Its IUPAC name is 3-[(7-fluoro-2-hydroxy-5-methyl-1H-indol-3-yl)diazenyl]-N-[(7-fluoro-2-hydroxy-5-methyl-1H-indol-3-yl)imino]benzamide.
| Compound Name | 3-[(7-fluoro-2-hydroxy-5-methyl-1H-indol-3-yl)diazenyl]-N-[(7-fluoro-2-hydroxy-5-methyl-1H-indol-3-yl)imino]benzamide |
|---|---|
| PubChem CID | 166205930 |
| Molecular Formula | C25H18F2N6O3 |
| Molecular Weight | 488.45 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | 3-[(7-fluoro-2-hydroxy-5-methyl-1H-indol-3-yl)diazenyl]-N-[(7-fluoro-2-hydroxy-5-methyl-1H-indol-3-yl)imino]benzamide |
| SMILES | Cc1cc(F)c2[nH]c(O)c(/N=N/C(=O)c3cccc(/N=N/c4c(O)[nH]c5c(F)cc(C)cc45)c3)c2c1 |
| InChI | InChI=1S/C25H18F2N6O3/c1-11-6-15-19(17(26)8-11)28-24(35)21(15)31-30-14-5-3-4-13(10-14)23(34)33-32-22-16-7-12(2)9-18(27)20(16)29-25(22)36/h3-10,28-29,35-36H,1-2H3/b31-30+,33-32+ |
| InChIKey | XZSOFLRGMHIZOC-CJQWSLHQSA-N |
| XLogP | 7.29 |
| TPSA | 138.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.45 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|