C14H15N5O — CID 136870728
2-[[4-(methylaminomethyl)imidazol-1-yl]methyl]-3H-quinazolin-4-one (PubChem CID 136870728) has the molecular formula C14H15N5O and a molecular weight of 269.31 g/mol. Its IUPAC name is 2-[[4-(methylaminomethyl)imidazol-1-yl]methyl]-3H-quinazolin-4-one.
| Compound Name | 2-[[4-(methylaminomethyl)imidazol-1-yl]methyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 136870728 |
| Molecular Formula | C14H15N5O |
| Molecular Weight | 269.31 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | 2-[[4-(methylaminomethyl)imidazol-1-yl]methyl]-3H-quinazolin-4-one |
| SMILES | CNCc1cn(Cc2nc3ccccc3c(=O)[nH]2)cn1 |
| InChI | InChI=1S/C14H15N5O/c1-15-6-10-7-19(9-16-10)8-13-17-12-5-3-2-4-11(12)14(20)18-13/h2-5,7,9,15H,6,8H2,1H3,(H,17,18,20) |
| InChIKey | HCRUPFKUNZDVKY-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.31 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |