C17H25N3O3 — CID 136882512
6-hydroxy-1,3-dimethyl-5-[[(1S,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]iminomethyl]pyrimidine-2,4-dione (PubChem CID 136882512) has the molecular formula C17H25N3O3 and a molecular weight of 319.41 g/mol. Its IUPAC name is 6-hydroxy-1,3-dimethyl-5-[[(1S,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]iminomethyl]pyrimidine-2,4-dione.
| Compound Name | 6-hydroxy-1,3-dimethyl-5-[[(1S,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]iminomethyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 136882512 |
| Molecular Formula | C17H25N3O3 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | 6-hydroxy-1,3-dimethyl-5-[[(1S,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]iminomethyl]pyrimidine-2,4-dione |
| SMILES | Cn1c(O)c(/C=N/[C@@H]2C[C@H]3CC[C@@]2(C)C3(C)C)c(=O)n(C)c1=O |
| InChI | InChI=1S/C17H25N3O3/c1-16(2)10-6-7-17(16,3)12(8-10)18-9-11-13(21)19(4)15(23)20(5)14(11)22/h9-10,12,21H,6-8H2,1-5H3/b18-9+/t10-,12-,17-/m1/s1 |
| InChIKey | JFCFRVOIGQNKOF-FPJPMSSPSA-N |
| XLogP | 1.42 |
| TPSA | 76.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|