C13H9F3N2O5 — CID 136882814
methyl 5-hydroxy-6-oxo-2-[4-(trifluoromethoxy)phenyl]-1H-pyrimidine-4-carboxylate (PubChem CID 136882814) has the molecular formula C13H9F3N2O5 and a molecular weight of 330.22 g/mol. Its IUPAC name is methyl 5-hydroxy-6-oxo-2-[4-(trifluoromethoxy)phenyl]-1H-pyrimidine-4-carboxylate.
| Compound Name | methyl 5-hydroxy-6-oxo-2-[4-(trifluoromethoxy)phenyl]-1H-pyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 136882814 |
| Molecular Formula | C13H9F3N2O5 |
| Molecular Weight | 330.22 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | methyl 5-hydroxy-6-oxo-2-[4-(trifluoromethoxy)phenyl]-1H-pyrimidine-4-carboxylate |
| SMILES | COC(=O)c1nc(-c2ccc(OC(F)(F)F)cc2)[nH]c(=O)c1O |
| InChI | InChI=1S/C13H9F3N2O5/c1-22-12(21)8-9(19)11(20)18-10(17-8)6-2-4-7(5-3-6)23-13(14,15)16/h2-5,19H,1H3,(H,17,18,20) |
| InChIKey | VAZCKTGEZOHTMV-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 101.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.22 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |