C11H12N4O — CID 136883787
4-amino-6-(1-phenylethyl)-1H-1,3,5-triazin-2-one (PubChem CID 136883787) has the molecular formula C11H12N4O and a molecular weight of 216.24 g/mol. Its IUPAC name is 4-amino-6-(1-phenylethyl)-1H-1,3,5-triazin-2-one.
| Compound Name | 4-amino-6-(1-phenylethyl)-1H-1,3,5-triazin-2-one |
|---|---|
| PubChem CID | 136883787 |
| Molecular Formula | C11H12N4O |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | 4-amino-6-(1-phenylethyl)-1H-1,3,5-triazin-2-one |
| SMILES | CC(c1ccccc1)c1nc(N)nc(=O)[nH]1 |
| InChI | InChI=1S/C11H12N4O/c1-7(8-5-3-2-4-6-8)9-13-10(12)15-11(16)14-9/h2-7H,1H3,(H3,12,13,14,15,16) |
| InChIKey | JOKHHFBMRKIMKY-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |