C15H19N3O2 — CID 136889452
4-[5-(1-aminopropan-2-yl)-4,6-dimethylpyrimidin-2-yl]benzene-1,2-diol (PubChem CID 136889452) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is 4-[5-(1-aminopropan-2-yl)-4,6-dimethylpyrimidin-2-yl]benzene-1,2-diol.
| Compound Name | 4-[5-(1-aminopropan-2-yl)-4,6-dimethylpyrimidin-2-yl]benzene-1,2-diol |
|---|---|
| PubChem CID | 136889452 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 4-[5-(1-aminopropan-2-yl)-4,6-dimethylpyrimidin-2-yl]benzene-1,2-diol |
| SMILES | Cc1nc(-c2ccc(O)c(O)c2)nc(C)c1C(C)CN |
| InChI | InChI=1S/C15H19N3O2/c1-8(7-16)14-9(2)17-15(18-10(14)3)11-4-5-12(19)13(20)6-11/h4-6,8,19-20H,7,16H2,1-3H3 |
| InChIKey | CQZSLZHOEWQZNS-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|