C13H16F4N2O2 — CID 136890420
2-(2,2,3,3-tetrafluoropropoxymethyl)-3,5,6,7,8,9-hexahydrocyclohepta[d]pyrimidin-4-one (PubChem CID 136890420) has the molecular formula C13H16F4N2O2 and a molecular weight of 308.28 g/mol. Its IUPAC name is 2-(2,2,3,3-tetrafluoropropoxymethyl)-3,5,6,7,8,9-hexahydrocyclohepta[d]pyrimidin-4-one.
| Compound Name | 2-(2,2,3,3-tetrafluoropropoxymethyl)-3,5,6,7,8,9-hexahydrocyclohepta[d]pyrimidin-4-one |
|---|---|
| PubChem CID | 136890420 |
| Molecular Formula | C13H16F4N2O2 |
| Molecular Weight | 308.28 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | 2-(2,2,3,3-tetrafluoropropoxymethyl)-3,5,6,7,8,9-hexahydrocyclohepta[d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(COCC(F)(F)C(F)F)nc2c1CCCCC2 |
| InChI | InChI=1S/C13H16F4N2O2/c14-12(15)13(16,17)7-21-6-10-18-9-5-3-1-2-4-8(9)11(20)19-10/h12H,1-7H2,(H,18,19,20) |
| InChIKey | ACRCVWIPDJIDPO-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.28 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|