C11H13F4IN2O2 — CID 136890434
5-iodo-4-propyl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidin-6-one (PubChem CID 136890434) has the molecular formula C11H13F4IN2O2 and a molecular weight of 408.13 g/mol. Its IUPAC name is 5-iodo-4-propyl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidin-6-one.
| Compound Name | 5-iodo-4-propyl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136890434 |
| Molecular Formula | C11H13F4IN2O2 |
| Molecular Weight | 408.13 g/mol |
| Exact Mass | 408.00 |
| IUPAC Name | 5-iodo-4-propyl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidin-6-one |
| SMILES | CCCc1nc(COCC(F)(F)C(F)F)[nH]c(=O)c1I |
| InChI | InChI=1S/C11H13F4IN2O2/c1-2-3-6-8(16)9(19)18-7(17-6)4-20-5-11(14,15)10(12)13/h10H,2-5H2,1H3,(H,17,18,19) |
| InChIKey | WKNUDRGHQBPDLO-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.13 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|