C12H15BrF4N2O2 — CID 136890436
5-bromo-4-tert-butyl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidin-6-one (PubChem CID 136890436) has the molecular formula C12H15BrF4N2O2 and a molecular weight of 375.16 g/mol. Its IUPAC name is 5-bromo-4-tert-butyl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidin-6-one.
| Compound Name | 5-bromo-4-tert-butyl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136890436 |
| Molecular Formula | C12H15BrF4N2O2 |
| Molecular Weight | 375.16 g/mol |
| Exact Mass | 374.03 |
| IUPAC Name | 5-bromo-4-tert-butyl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidin-6-one |
| SMILES | CC(C)(C)c1nc(COCC(F)(F)C(F)F)[nH]c(=O)c1Br |
| InChI | InChI=1S/C12H15BrF4N2O2/c1-11(2,3)8-7(13)9(20)19-6(18-8)4-21-5-12(16,17)10(14)15/h10H,4-5H2,1-3H3,(H,18,19,20) |
| InChIKey | RWGQDJVPSQHSOV-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.16 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|