C11H11F4IN2O2 — CID 136890453
4-cyclopropyl-5-iodo-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidin-6-one (PubChem CID 136890453) has the molecular formula C11H11F4IN2O2 and a molecular weight of 406.12 g/mol. Its IUPAC name is 4-cyclopropyl-5-iodo-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidin-6-one.
| Compound Name | 4-cyclopropyl-5-iodo-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136890453 |
| Molecular Formula | C11H11F4IN2O2 |
| Molecular Weight | 406.12 g/mol |
| Exact Mass | 405.98 |
| IUPAC Name | 4-cyclopropyl-5-iodo-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]c(COCC(F)(F)C(F)F)nc(C2CC2)c1I |
| InChI | InChI=1S/C11H11F4IN2O2/c12-10(13)11(14,15)4-20-3-6-17-8(5-1-2-5)7(16)9(19)18-6/h5,10H,1-4H2,(H,17,18,19) |
| InChIKey | KJKGMAJKPWLWFK-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.12 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|