C11H12F4N2O4 — CID 136890469
2-[4-methyl-6-oxo-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidin-5-yl]acetic acid (PubChem CID 136890469) has the molecular formula C11H12F4N2O4 and a molecular weight of 312.22 g/mol. Its IUPAC name is 2-[4-methyl-6-oxo-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidin-5-yl]acetic acid.
| Compound Name | 2-[4-methyl-6-oxo-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidin-5-yl]acetic acid |
|---|---|
| PubChem CID | 136890469 |
| Molecular Formula | C11H12F4N2O4 |
| Molecular Weight | 312.22 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | 2-[4-methyl-6-oxo-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidin-5-yl]acetic acid |
| SMILES | Cc1nc(COCC(F)(F)C(F)F)[nH]c(=O)c1CC(=O)O |
| InChI | InChI=1S/C11H12F4N2O4/c1-5-6(2-8(18)19)9(20)17-7(16-5)3-21-4-11(14,15)10(12)13/h10H,2-4H2,1H3,(H,18,19)(H,16,17,20) |
| InChIKey | OEDZAHZQTOXULS-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 92.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.22 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|