C12H17F4N3O2 — CID 136890499
4-(propylaminomethyl)-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidin-6-one (PubChem CID 136890499) has the molecular formula C12H17F4N3O2 and a molecular weight of 311.28 g/mol. Its IUPAC name is 4-(propylaminomethyl)-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidin-6-one.
| Compound Name | 4-(propylaminomethyl)-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136890499 |
| Molecular Formula | C12H17F4N3O2 |
| Molecular Weight | 311.28 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 4-(propylaminomethyl)-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidin-6-one |
| SMILES | CCCNCc1cc(=O)[nH]c(COCC(F)(F)C(F)F)n1 |
| InChI | InChI=1S/C12H17F4N3O2/c1-2-3-17-5-8-4-10(20)19-9(18-8)6-21-7-12(15,16)11(13)14/h4,11,17H,2-3,5-7H2,1H3,(H,18,19,20) |
| InChIKey | OOCAGHAKNHZSQY-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.28 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|