C9H10F3N3O2 — CID 136890510
2-(2,2,2-trifluoroethoxymethyl)-3,5,6,7-tetrahydropyrrolo[3,4-d]pyrimidin-4-one (PubChem CID 136890510) has the molecular formula C9H10F3N3O2 and a molecular weight of 249.19 g/mol. Its IUPAC name is 2-(2,2,2-trifluoroethoxymethyl)-3,5,6,7-tetrahydropyrrolo[3,4-d]pyrimidin-4-one.
| Compound Name | 2-(2,2,2-trifluoroethoxymethyl)-3,5,6,7-tetrahydropyrrolo[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 136890510 |
| Molecular Formula | C9H10F3N3O2 |
| Molecular Weight | 249.19 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | 2-(2,2,2-trifluoroethoxymethyl)-3,5,6,7-tetrahydropyrrolo[3,4-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(COCC(F)(F)F)nc2c1CNC2 |
| InChI | InChI=1S/C9H10F3N3O2/c10-9(11,12)4-17-3-7-14-6-2-13-1-5(6)8(16)15-7/h13H,1-4H2,(H,14,15,16) |
| InChIKey | DUMMWUDSEUOPJV-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.19 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |