C11H13F4N3O2 — CID 136890509
2-(2,2,3,3-tetrafluoropropoxymethyl)-5,6,7,8-tetrahydro-3H-pyrido[4,3-d]pyrimidin-4-one (PubChem CID 136890509) has the molecular formula C11H13F4N3O2 and a molecular weight of 295.24 g/mol. Its IUPAC name is 2-(2,2,3,3-tetrafluoropropoxymethyl)-5,6,7,8-tetrahydro-3H-pyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 2-(2,2,3,3-tetrafluoropropoxymethyl)-5,6,7,8-tetrahydro-3H-pyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 136890509 |
| Molecular Formula | C11H13F4N3O2 |
| Molecular Weight | 295.24 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | 2-(2,2,3,3-tetrafluoropropoxymethyl)-5,6,7,8-tetrahydro-3H-pyrido[4,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(COCC(F)(F)C(F)F)nc2c1CNCC2 |
| InChI | InChI=1S/C11H13F4N3O2/c12-10(13)11(14,15)5-20-4-8-17-7-1-2-16-3-6(7)9(19)18-8/h10,16H,1-5H2,(H,17,18,19) |
| InChIKey | ANIYERHVJNBFLN-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.24 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|