C10H11F4N3O2 — CID 136890511
2-(2,2,3,3-tetrafluoropropoxymethyl)-3,5,6,7-tetrahydropyrrolo[3,4-d]pyrimidin-4-one (PubChem CID 136890511) has the molecular formula C10H11F4N3O2 and a molecular weight of 281.21 g/mol. Its IUPAC name is 2-(2,2,3,3-tetrafluoropropoxymethyl)-3,5,6,7-tetrahydropyrrolo[3,4-d]pyrimidin-4-one.
| Compound Name | 2-(2,2,3,3-tetrafluoropropoxymethyl)-3,5,6,7-tetrahydropyrrolo[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 136890511 |
| Molecular Formula | C10H11F4N3O2 |
| Molecular Weight | 281.21 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 2-(2,2,3,3-tetrafluoropropoxymethyl)-3,5,6,7-tetrahydropyrrolo[3,4-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(COCC(F)(F)C(F)F)nc2c1CNC2 |
| InChI | InChI=1S/C10H11F4N3O2/c11-9(12)10(13,14)4-19-3-7-16-6-2-15-1-5(6)8(18)17-7/h9,15H,1-4H2,(H,16,17,18) |
| InChIKey | ZWBYYECUMUEZLP-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.21 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|