C22H15N5O6 — CID 136897272
N-[(Z)-(2-hydroxy-3-nitrophenyl)methylideneamino]-5-nitro-3-phenyl-1H-indole-2-carboxamide (PubChem CID 136897272) has the molecular formula C22H15N5O6 and a molecular weight of 445.39 g/mol. Its IUPAC name is N-[(Z)-(2-hydroxy-3-nitrophenyl)methylideneamino]-5-nitro-3-phenyl-1H-indole-2-carboxamide.
| Compound Name | N-[(Z)-(2-hydroxy-3-nitrophenyl)methylideneamino]-5-nitro-3-phenyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 136897272 |
| Molecular Formula | C22H15N5O6 |
| Molecular Weight | 445.39 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | N-[(Z)-(2-hydroxy-3-nitrophenyl)methylideneamino]-5-nitro-3-phenyl-1H-indole-2-carboxamide |
| SMILES | O=C(N/N=C\c1cccc([N+](=O)[O-])c1O)c1[nH]c2ccc([N+](=O)[O-])cc2c1-c1ccccc1 |
| InChI | InChI=1S/C22H15N5O6/c28-21-14(7-4-8-18(21)27(32)33)12-23-25-22(29)20-19(13-5-2-1-3-6-13)16-11-15(26(30)31)9-10-17(16)24-20/h1-12,24,28H,(H,25,29)/b23-12- |
| InChIKey | FADAHXRSNCZVBL-FMCGGJTJSA-N |
| XLogP | 4.12 |
| TPSA | 163.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.39 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|