C24H18N3O3- — CID 3689306
2-[[(5-methyl-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]benzoate (PubChem CID 3689306) has the molecular formula C24H18N3O3- and a molecular weight of 396.43 g/mol. Its IUPAC name is 2-[[(5-methyl-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]benzoate.
| Compound Name | 2-[[(5-methyl-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]benzoate |
|---|---|
| PubChem CID | 3689306 |
| Molecular Formula | C24H18N3O3- |
| Molecular Weight | 396.43 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | 2-[[(5-methyl-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]benzoate |
| SMILES | Cc1ccc2[nH]c(C(=O)NN=Cc3ccccc3C(=O)[O-])c(-c3ccccc3)c2c1 |
| InChI | InChI=1S/C24H19N3O3/c1-15-11-12-20-19(13-15)21(16-7-3-2-4-8-16)22(26-20)23(28)27-25-14-17-9-5-6-10-18(17)24(29)30/h2-14,26H,1H3,(H,27,28)(H,29,30)/p-1 |
| InChIKey | ZUBGALRJJRWZIM-UHFFFAOYSA-M |
| XLogP | 3.27 |
| TPSA | 97.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.43 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|