C12H13N3OS — CID 136900433
(NZ)-N-[1-(4-methyl-1,2,5-thiadiazol-3-yl)-3-phenylpropylidene]hydroxylamine (PubChem CID 136900433) has the molecular formula C12H13N3OS and a molecular weight of 247.32 g/mol. Its IUPAC name is (NZ)-N-[1-(4-methyl-1,2,5-thiadiazol-3-yl)-3-phenylpropylidene]hydroxylamine.
| Compound Name | (NZ)-N-[1-(4-methyl-1,2,5-thiadiazol-3-yl)-3-phenylpropylidene]hydroxylamine |
|---|---|
| PubChem CID | 136900433 |
| Molecular Formula | C12H13N3OS |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | (NZ)-N-[1-(4-methyl-1,2,5-thiadiazol-3-yl)-3-phenylpropylidene]hydroxylamine |
| SMILES | Cc1nsnc1/C(CCc1ccccc1)=N\O |
| InChI | InChI=1S/C12H13N3OS/c1-9-12(15-17-14-9)11(13-16)8-7-10-5-3-2-4-6-10/h2-6,16H,7-8H2,1H3/b13-11- |
| InChIKey | SFFJGGDMUXMOOH-QBFSEMIESA-N |
| XLogP | 2.66 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|