C11H13N7O2 — CID 136905920
N-[4-[(Z)-N'-hydroxycarbamimidoyl]-1H-pyrazol-5-yl]-3,6-dimethylpyridazine-4-carboxamide (PubChem CID 136905920) has the molecular formula C11H13N7O2 and a molecular weight of 275.27 g/mol. Its IUPAC name is N-[4-[(Z)-N'-hydroxycarbamimidoyl]-1H-pyrazol-5-yl]-3,6-dimethylpyridazine-4-carboxamide.
| Compound Name | N-[4-[(Z)-N'-hydroxycarbamimidoyl]-1H-pyrazol-5-yl]-3,6-dimethylpyridazine-4-carboxamide |
|---|---|
| PubChem CID | 136905920 |
| Molecular Formula | C11H13N7O2 |
| Molecular Weight | 275.27 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | N-[4-[(Z)-N'-hydroxycarbamimidoyl]-1H-pyrazol-5-yl]-3,6-dimethylpyridazine-4-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2[nH]ncc2/C(N)=N/O)c(C)nn1 |
| InChI | InChI=1S/C11H13N7O2/c1-5-3-7(6(2)16-15-5)11(19)14-10-8(4-13-17-10)9(12)18-20/h3-4,20H,1-2H3,(H2,12,18)(H2,13,14,17,19) |
| InChIKey | VUNPGZDPKCNHRH-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 142.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.27 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|