C11H9BrFN5O2 — CID 137005417
2-bromo-6-fluoro-N-[4-[(E)-N'-hydroxycarbamimidoyl]-1H-pyrazol-5-yl]benzamide (PubChem CID 137005417) has the molecular formula C11H9BrFN5O2 and a molecular weight of 342.13 g/mol. Its IUPAC name is 2-bromo-6-fluoro-N-[4-[(E)-N'-hydroxycarbamimidoyl]-1H-pyrazol-5-yl]benzamide.
| Compound Name | 2-bromo-6-fluoro-N-[4-[(E)-N'-hydroxycarbamimidoyl]-1H-pyrazol-5-yl]benzamide |
|---|---|
| PubChem CID | 137005417 |
| Molecular Formula | C11H9BrFN5O2 |
| Molecular Weight | 342.13 g/mol |
| Exact Mass | 340.99 |
| IUPAC Name | 2-bromo-6-fluoro-N-[4-[(E)-N'-hydroxycarbamimidoyl]-1H-pyrazol-5-yl]benzamide |
| SMILES | N/C(=N/O)c1cn[nH]c1NC(=O)c1c(F)cccc1Br |
| InChI | InChI=1S/C11H9BrFN5O2/c12-6-2-1-3-7(13)8(6)11(19)16-10-5(4-15-17-10)9(14)18-20/h1-4,20H,(H2,14,18)(H2,15,16,17,19) |
| InChIKey | WHHLYVZHXVJWBH-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 116.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.13 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|