C37H11F15N4 — CID 136916270
6,11,16-tris(2,3,4,5,6-pentafluorophenyl)-8,20,21,23-tetrazapentacyclo[15.2.1.12,5.17,10.112,15]tricosa-1,3,5(23),6,8,10,12,14,16,18-decaene (PubChem CID 136916270) has the molecular formula C37H11F15N4 and a molecular weight of 796.49 g/mol. Its IUPAC name is 6,11,16-tris(2,3,4,5,6-pentafluorophenyl)-8,20,21,23-tetrazapentacyclo[15.2.1.12,5.17,10.112,15]tricosa-1,3,5(23),6,8,10,12,14,16,18-decaene.
| Compound Name | 6,11,16-tris(2,3,4,5,6-pentafluorophenyl)-8,20,21,23-tetrazapentacyclo[15.2.1.12,5.17,10.112,15]tricosa-1,3,5(23),6,8,10,12,14,16,18-decaene |
|---|---|
| PubChem CID | 136916270 |
| Molecular Formula | C37H11F15N4 |
| Molecular Weight | 796.49 g/mol |
| Exact Mass | 796.07 |
| IUPAC Name | 6,11,16-tris(2,3,4,5,6-pentafluorophenyl)-8,20,21,23-tetrazapentacyclo[15.2.1.12,5.17,10.112,15]tricosa-1,3,5(23),6,8,10,12,14,16,18-decaene |
| SMILES | Fc1c(F)c(F)c(/C2=c3\cc/c([nH]3)=C3\C=CC(=N3)/C(c3c(F)c(F)c(F)c(F)c3F)=C3\C/C(=C(/c4c(F)c(F)c(F)c(F)c4F)c4ccc2[nH]4)C=N3)c(F)c1F |
| InChI | InChI=1S/C37H11F15N4/c38-23-20(24(39)30(45)35(50)29(23)44)17-9-7-16(53-8-9)19(22-27(42)33(48)37(52)34(49)28(22)43)15-4-2-11(55-15)10-1-3-13(54-10)18(14-6-5-12(17)56-14)21-25(40)31(46)36(51)32(47)26(21)41/h1-6,8,54,56H,7H2/b11-10-,17-9-,17-12+,18-13+,18-14+,19-15+,19-16- |
| InChIKey | WJEMFTGARKMBMS-SUYFKWLJSA-N |
| XLogP | 8.50 |
| TPSA | 56.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.49 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|