C23H15N5O2S — CID 136916630
1-[(Z)-2-cyano-3-naphthalen-2-yl-3-oxoprop-1-enyl]-3-[(2-hydroxy-1H-indol-3-yl)imino]thiourea (PubChem CID 136916630) has the molecular formula C23H15N5O2S and a molecular weight of 425.47 g/mol. Its IUPAC name is 1-[(Z)-2-cyano-3-naphthalen-2-yl-3-oxoprop-1-enyl]-3-[(2-hydroxy-1H-indol-3-yl)imino]thiourea.
| Compound Name | 1-[(Z)-2-cyano-3-naphthalen-2-yl-3-oxoprop-1-enyl]-3-[(2-hydroxy-1H-indol-3-yl)imino]thiourea |
|---|---|
| PubChem CID | 136916630 |
| Molecular Formula | C23H15N5O2S |
| Molecular Weight | 425.47 g/mol |
| Exact Mass | 425.09 |
| IUPAC Name | 1-[(Z)-2-cyano-3-naphthalen-2-yl-3-oxoprop-1-enyl]-3-[(2-hydroxy-1H-indol-3-yl)imino]thiourea |
| SMILES | N#C/C(=C/NC(=S)/N=N/c1c(O)[nH]c2ccccc12)C(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C23H15N5O2S/c24-12-17(21(29)16-10-9-14-5-1-2-6-15(14)11-16)13-25-23(31)28-27-20-18-7-3-4-8-19(18)26-22(20)30/h1-11,13,26,30H,(H,25,31)/b17-13-,28-27+ |
| InChIKey | PCSQZEARNNHCES-KSPGMZAQSA-N |
| XLogP | 5.28 |
| TPSA | 113.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.47 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|