C27H27N3OS — CID 3454354
1-(2-tert-butyl-6-ethylphenyl)-3-(2-cyano-3-naphthalen-2-yl-3-oxoprop-1-enyl)thiourea (PubChem CID 3454354) has the molecular formula C27H27N3OS and a molecular weight of 441.60 g/mol. Its IUPAC name is 1-(2-tert-butyl-6-ethylphenyl)-3-(2-cyano-3-naphthalen-2-yl-3-oxoprop-1-enyl)thiourea.
| Compound Name | 1-(2-tert-butyl-6-ethylphenyl)-3-(2-cyano-3-naphthalen-2-yl-3-oxoprop-1-enyl)thiourea |
|---|---|
| PubChem CID | 3454354 |
| Molecular Formula | C27H27N3OS |
| Molecular Weight | 441.60 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | 1-(2-tert-butyl-6-ethylphenyl)-3-(2-cyano-3-naphthalen-2-yl-3-oxoprop-1-enyl)thiourea |
| SMILES | CCc1cccc(C(C)(C)C)c1NC(=S)NC=C(C#N)C(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C27H27N3OS/c1-5-18-11-8-12-23(27(2,3)4)24(18)30-26(32)29-17-22(16-28)25(31)21-14-13-19-9-6-7-10-20(19)15-21/h6-15,17H,5H2,1-4H3,(H2,29,30,32) |
| InChIKey | CPCDXHWTPWKWOM-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.60 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|