C22H22N4O3S — CID 136917263
5-[(2R)-2-[4-(dimethylamino)phenyl]-2,3-dihydro-1,5-benzothiazepin-4-yl]-6-hydroxy-1-methylpyrimidine-2,4-dione (PubChem CID 136917263) has the molecular formula C22H22N4O3S and a molecular weight of 422.51 g/mol. Its IUPAC name is 5-[(2R)-2-[4-(dimethylamino)phenyl]-2,3-dihydro-1,5-benzothiazepin-4-yl]-6-hydroxy-1-methylpyrimidine-2,4-dione.
| Compound Name | 5-[(2R)-2-[4-(dimethylamino)phenyl]-2,3-dihydro-1,5-benzothiazepin-4-yl]-6-hydroxy-1-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 136917263 |
| Molecular Formula | C22H22N4O3S |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | 5-[(2R)-2-[4-(dimethylamino)phenyl]-2,3-dihydro-1,5-benzothiazepin-4-yl]-6-hydroxy-1-methylpyrimidine-2,4-dione |
| SMILES | CN(C)c1ccc([C@H]2CC(c3c(O)n(C)c(=O)[nH]c3=O)=Nc3ccccc3S2)cc1 |
| InChI | InChI=1S/C22H22N4O3S/c1-25(2)14-10-8-13(9-11-14)18-12-16(23-15-6-4-5-7-17(15)30-18)19-20(27)24-22(29)26(3)21(19)28/h4-11,18,28H,12H2,1-3H3,(H,24,27,29)/t18-/m1/s1 |
| InChIKey | KBKJGKWCHBXPDW-GOSISDBHSA-N |
| XLogP | 3.20 |
| TPSA | 90.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|