C23H22ClN3O2S2 — CID 136879816
1-butyl-5-[(2R)-2-(4-chlorophenyl)-2,3-dihydro-1,5-benzothiazepin-4-yl]-6-hydroxy-2-sulfanylidenepyrimidin-4-one (PubChem CID 136879816) has the molecular formula C23H22ClN3O2S2 and a molecular weight of 472.04 g/mol. Its IUPAC name is 1-butyl-5-[(2R)-2-(4-chlorophenyl)-2,3-dihydro-1,5-benzothiazepin-4-yl]-6-hydroxy-2-sulfanylidenepyrimidin-4-one.
| Compound Name | 1-butyl-5-[(2R)-2-(4-chlorophenyl)-2,3-dihydro-1,5-benzothiazepin-4-yl]-6-hydroxy-2-sulfanylidenepyrimidin-4-one |
|---|---|
| PubChem CID | 136879816 |
| Molecular Formula | C23H22ClN3O2S2 |
| Molecular Weight | 472.04 g/mol |
| Exact Mass | 471.08 |
| IUPAC Name | 1-butyl-5-[(2R)-2-(4-chlorophenyl)-2,3-dihydro-1,5-benzothiazepin-4-yl]-6-hydroxy-2-sulfanylidenepyrimidin-4-one |
| SMILES | CCCCn1c(O)c(C2=Nc3ccccc3S[C@@H](c3ccc(Cl)cc3)C2)c(=O)[nH]c1=S |
| InChI | InChI=1S/C23H22ClN3O2S2/c1-2-3-12-27-22(29)20(21(28)26-23(27)30)17-13-19(14-8-10-15(24)11-9-14)31-18-7-5-4-6-16(18)25-17/h4-11,19,29H,2-3,12-13H2,1H3,(H,26,28,30)/t19-/m1/s1 |
| InChIKey | RYYJZSKHMZIZII-LJQANCHMSA-N |
| XLogP | 6.42 |
| TPSA | 70.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.04 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|