C23H22N4O4S2 — CID 136879651
1-butyl-6-hydroxy-5-[(2S)-2-(3-nitrophenyl)-2,3-dihydro-1,5-benzothiazepin-4-yl]-2-sulfanylidenepyrimidin-4-one (PubChem CID 136879651) has the molecular formula C23H22N4O4S2 and a molecular weight of 482.59 g/mol. Its IUPAC name is 1-butyl-6-hydroxy-5-[(2S)-2-(3-nitrophenyl)-2,3-dihydro-1,5-benzothiazepin-4-yl]-2-sulfanylidenepyrimidin-4-one.
| Compound Name | 1-butyl-6-hydroxy-5-[(2S)-2-(3-nitrophenyl)-2,3-dihydro-1,5-benzothiazepin-4-yl]-2-sulfanylidenepyrimidin-4-one |
|---|---|
| PubChem CID | 136879651 |
| Molecular Formula | C23H22N4O4S2 |
| Molecular Weight | 482.59 g/mol |
| Exact Mass | 482.11 |
| IUPAC Name | 1-butyl-6-hydroxy-5-[(2S)-2-(3-nitrophenyl)-2,3-dihydro-1,5-benzothiazepin-4-yl]-2-sulfanylidenepyrimidin-4-one |
| SMILES | CCCCn1c(O)c(C2=Nc3ccccc3S[C@H](c3cccc([N+](=O)[O-])c3)C2)c(=O)[nH]c1=S |
| InChI | InChI=1S/C23H22N4O4S2/c1-2-3-11-26-22(29)20(21(28)25-23(26)32)17-13-19(14-7-6-8-15(12-14)27(30)31)33-18-10-5-4-9-16(18)24-17/h4-10,12,19,29H,2-3,11,13H2,1H3,(H,25,28,32)/t19-/m0/s1 |
| InChIKey | IQLQFCNVKOGRDQ-IBGZPJMESA-N |
| XLogP | 5.68 |
| TPSA | 113.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.59 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|