C18H15N3O2S3 — CID 135896770
6-hydroxy-1-methyl-2-sulfanylidene-5-(2-thiophen-2-yl-2,3-dihydro-1,5-benzothiazepin-4-yl)pyrimidin-4-one (PubChem CID 135896770) has the molecular formula C18H15N3O2S3 and a molecular weight of 401.54 g/mol. Its IUPAC name is 6-hydroxy-1-methyl-2-sulfanylidene-5-(2-thiophen-2-yl-2,3-dihydro-1,5-benzothiazepin-4-yl)pyrimidin-4-one.
| Compound Name | 6-hydroxy-1-methyl-2-sulfanylidene-5-(2-thiophen-2-yl-2,3-dihydro-1,5-benzothiazepin-4-yl)pyrimidin-4-one |
|---|---|
| PubChem CID | 135896770 |
| Molecular Formula | C18H15N3O2S3 |
| Molecular Weight | 401.54 g/mol |
| Exact Mass | 401.03 |
| IUPAC Name | 6-hydroxy-1-methyl-2-sulfanylidene-5-(2-thiophen-2-yl-2,3-dihydro-1,5-benzothiazepin-4-yl)pyrimidin-4-one |
| SMILES | Cn1c(O)c(C2=Nc3ccccc3SC(c3cccs3)C2)c(=O)[nH]c1=S |
| InChI | InChI=1S/C18H15N3O2S3/c1-21-17(23)15(16(22)20-18(21)24)11-9-14(13-7-4-8-25-13)26-12-6-3-2-5-10(12)19-11/h2-8,14,23H,9H2,1H3,(H,20,22,24) |
| InChIKey | DXVCHQSFLNTNEW-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 70.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.54 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|