C45H36N6O9 — CID 136918647
N-[5-[3,5-bis[3-[[hydroxy(phenoxy)methylidene]amino]-4-methylphenyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]-2-methylphenyl]-1-phenoxymethanimidic acid (PubChem CID 136918647) has the molecular formula C45H36N6O9 and a molecular weight of 804.82 g/mol. Its IUPAC name is N-[5-[3,5-bis[3-[[hydroxy(phenoxy)methylidene]amino]-4-methylphenyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]-2-methylphenyl]-1-phenoxymethanimidic acid.
| Compound Name | N-[5-[3,5-bis[3-[[hydroxy(phenoxy)methylidene]amino]-4-methylphenyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]-2-methylphenyl]-1-phenoxymethanimidic acid |
|---|---|
| PubChem CID | 136918647 |
| Molecular Formula | C45H36N6O9 |
| Molecular Weight | 804.82 g/mol |
| Exact Mass | 804.25 |
| IUPAC Name | N-[5-[3,5-bis[3-[[hydroxy(phenoxy)methylidene]amino]-4-methylphenyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]-2-methylphenyl]-1-phenoxymethanimidic acid |
| SMILES | Cc1ccc(-n2c(=O)n(-c3ccc(C)c(/N=C(\O)Oc4ccccc4)c3)c(=O)n(-c3ccc(C)c(/N=C(\O)Oc4ccccc4)c3)c2=O)cc1/N=C(\O)Oc1ccccc1 |
| InChI | InChI=1S/C45H36N6O9/c1-28-19-22-31(25-37(28)46-40(52)58-34-13-7-4-8-14-34)49-43(55)50(32-23-20-29(2)38(26-32)47-41(53)59-35-15-9-5-10-16-35)45(57)51(44(49)56)33-24-21-30(3)39(27-33)48-42(54)60-36-17-11-6-12-18-36/h4-27H,1-3H3,(H,46,52)(H,47,53)(H,48,54) |
| InChIKey | HIVSYBQYXIMMGH-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 191.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.82 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|