C23H19N3O5 — CID 136919380
3-hydroxy-4-[(Z)-[(5-methoxy-1-methylindole-2-carbonyl)hydrazinylidene]methyl]naphthalene-2-carboxylic acid (PubChem CID 136919380) has the molecular formula C23H19N3O5 and a molecular weight of 417.42 g/mol. Its IUPAC name is 3-hydroxy-4-[(Z)-[(5-methoxy-1-methylindole-2-carbonyl)hydrazinylidene]methyl]naphthalene-2-carboxylic acid.
| Compound Name | 3-hydroxy-4-[(Z)-[(5-methoxy-1-methylindole-2-carbonyl)hydrazinylidene]methyl]naphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 136919380 |
| Molecular Formula | C23H19N3O5 |
| Molecular Weight | 417.42 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | 3-hydroxy-4-[(Z)-[(5-methoxy-1-methylindole-2-carbonyl)hydrazinylidene]methyl]naphthalene-2-carboxylic acid |
| SMILES | COc1ccc2c(c1)cc(C(=O)N/N=C\c1c(O)c(C(=O)O)cc3ccccc13)n2C |
| InChI | InChI=1S/C23H19N3O5/c1-26-19-8-7-15(31-2)9-14(19)11-20(26)22(28)25-24-12-18-16-6-4-3-5-13(16)10-17(21(18)27)23(29)30/h3-12,27H,1-2H3,(H,25,28)(H,29,30)/b24-12- |
| InChIKey | GBLPGGPIXKBWGV-MSXFZWOLSA-N |
| XLogP | 3.51 |
| TPSA | 113.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.42 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|