C18H16N4O5 — CID 135842066
N-[(E)-(2-hydroxy-5-nitrophenyl)methylideneamino]-5-methoxy-1-methylindole-2-carboxamide (PubChem CID 135842066) has the molecular formula C18H16N4O5 and a molecular weight of 368.35 g/mol. Its IUPAC name is N-[(E)-(2-hydroxy-5-nitrophenyl)methylideneamino]-5-methoxy-1-methylindole-2-carboxamide.
| Compound Name | N-[(E)-(2-hydroxy-5-nitrophenyl)methylideneamino]-5-methoxy-1-methylindole-2-carboxamide |
|---|---|
| PubChem CID | 135842066 |
| Molecular Formula | C18H16N4O5 |
| Molecular Weight | 368.35 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | N-[(E)-(2-hydroxy-5-nitrophenyl)methylideneamino]-5-methoxy-1-methylindole-2-carboxamide |
| SMILES | COc1ccc2c(c1)cc(C(=O)N/N=C/c1cc([N+](=O)[O-])ccc1O)n2C |
| InChI | InChI=1S/C18H16N4O5/c1-21-15-5-4-14(27-2)8-11(15)9-16(21)18(24)20-19-10-12-7-13(22(25)26)3-6-17(12)23/h3-10,23H,1-2H3,(H,20,24)/b19-10+ |
| InChIKey | ZIAZVOSWAXLQAQ-VXLYETTFSA-N |
| XLogP | 2.56 |
| TPSA | 118.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.35 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|