C17H19N5O3 — CID 136925384
2-[5-amino-1-(2-hydroxyethyl)-3-(oxolan-2-yl)pyrazol-4-yl]-3H-quinazolin-4-one (PubChem CID 136925384) has the molecular formula C17H19N5O3 and a molecular weight of 341.37 g/mol. Its IUPAC name is 2-[5-amino-1-(2-hydroxyethyl)-3-(oxolan-2-yl)pyrazol-4-yl]-3H-quinazolin-4-one.
| Compound Name | 2-[5-amino-1-(2-hydroxyethyl)-3-(oxolan-2-yl)pyrazol-4-yl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 136925384 |
| Molecular Formula | C17H19N5O3 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | 2-[5-amino-1-(2-hydroxyethyl)-3-(oxolan-2-yl)pyrazol-4-yl]-3H-quinazolin-4-one |
| SMILES | Nc1c(-c2nc3ccccc3c(=O)[nH]2)c(C2CCCO2)nn1CCO |
| InChI | InChI=1S/C17H19N5O3/c18-15-13(14(12-6-3-9-25-12)21-22(15)7-8-23)16-19-11-5-2-1-4-10(11)17(24)20-16/h1-2,4-5,12,23H,3,6-9,18H2,(H,19,20,24) |
| InChIKey | QDUIHHGBYODZSI-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 119.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |