C16H24N5O7P — CID 136928181
2-amino-9-[(1R,2S,3S,4S)-4-(diethoxyphosphorylmethoxy)-2,3-dihydroxy-5-methylidenecyclopentyl]-1H-purin-6-one (PubChem CID 136928181) has the molecular formula C16H24N5O7P and a molecular weight of 429.37 g/mol. Its IUPAC name is 2-amino-9-[(1R,2S,3S,4S)-4-(diethoxyphosphorylmethoxy)-2,3-dihydroxy-5-methylidenecyclopentyl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[(1R,2S,3S,4S)-4-(diethoxyphosphorylmethoxy)-2,3-dihydroxy-5-methylidenecyclopentyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 136928181 |
| Molecular Formula | C16H24N5O7P |
| Molecular Weight | 429.37 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | 2-amino-9-[(1R,2S,3S,4S)-4-(diethoxyphosphorylmethoxy)-2,3-dihydroxy-5-methylidenecyclopentyl]-1H-purin-6-one |
| SMILES | C=C1[C@@H](n2cnc3c(=O)[nH]c(N)nc32)[C@H](O)[C@H](O)[C@H]1OCP(=O)(OCC)OCC |
| InChI | InChI=1S/C16H24N5O7P/c1-4-27-29(25,28-5-2)7-26-13-8(3)10(11(22)12(13)23)21-6-18-9-14(21)19-16(17)20-15(9)24/h6,10-13,22-23H,3-5,7H2,1-2H3,(H3,17,19,20,24)/t10-,11+,12+,13+/m1/s1 |
| InChIKey | BEPKQZVBELIZTO-VOAKCMCISA-N |
| XLogP | 0.14 |
| TPSA | 174.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.37 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|