C8H9N3S — CID 136952482
3-ethyl-7H-pyrrolo[2,3-d]pyrimidine-2-thione (PubChem CID 136952482) has the molecular formula C8H9N3S and a molecular weight of 179.25 g/mol. Its IUPAC name is 3-ethyl-7H-pyrrolo[2,3-d]pyrimidine-2-thione.
| Compound Name | 3-ethyl-7H-pyrrolo[2,3-d]pyrimidine-2-thione |
|---|---|
| PubChem CID | 136952482 |
| Molecular Formula | C8H9N3S |
| Molecular Weight | 179.25 g/mol |
| Exact Mass | 179.05 |
| IUPAC Name | 3-ethyl-7H-pyrrolo[2,3-d]pyrimidine-2-thione |
| SMILES | CCn1cc2cc[nH]c2nc1=S |
| InChI | InChI=1S/C8H9N3S/c1-2-11-5-6-3-4-9-7(6)10-8(11)12/h3-5H,2H2,1H3,(H,9,10,12) |
| InChIKey | IAIWIUBESYVNPG-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.25 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|