C10H13N3S — CID 137029355
5-methyl-3-propan-2-yl-7H-pyrrolo[2,3-d]pyrimidine-2-thione (PubChem CID 137029355) has the molecular formula C10H13N3S and a molecular weight of 207.30 g/mol. Its IUPAC name is 5-methyl-3-propan-2-yl-7H-pyrrolo[2,3-d]pyrimidine-2-thione.
| Compound Name | 5-methyl-3-propan-2-yl-7H-pyrrolo[2,3-d]pyrimidine-2-thione |
|---|---|
| PubChem CID | 137029355 |
| Molecular Formula | C10H13N3S |
| Molecular Weight | 207.30 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | 5-methyl-3-propan-2-yl-7H-pyrrolo[2,3-d]pyrimidine-2-thione |
| SMILES | Cc1c[nH]c2nc(=S)n(C(C)C)cc12 |
| InChI | InChI=1S/C10H13N3S/c1-6(2)13-5-8-7(3)4-11-9(8)12-10(13)14/h4-6H,1-3H3,(H,11,12,14) |
| InChIKey | GYSHLCMKVCQSAB-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.30 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|