C7H6FN3S — CID 136952484
5-fluoro-3-methyl-7H-pyrrolo[2,3-d]pyrimidine-2-thione (PubChem CID 136952484) has the molecular formula C7H6FN3S and a molecular weight of 183.21 g/mol. Its IUPAC name is 5-fluoro-3-methyl-7H-pyrrolo[2,3-d]pyrimidine-2-thione.
| Compound Name | 5-fluoro-3-methyl-7H-pyrrolo[2,3-d]pyrimidine-2-thione |
|---|---|
| PubChem CID | 136952484 |
| Molecular Formula | C7H6FN3S |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.03 |
| IUPAC Name | 5-fluoro-3-methyl-7H-pyrrolo[2,3-d]pyrimidine-2-thione |
| SMILES | Cn1cc2c(F)c[nH]c2nc1=S |
| InChI | InChI=1S/C7H6FN3S/c1-11-3-4-5(8)2-9-6(4)10-7(11)12/h2-3H,1H3,(H,9,10,12) |
| InChIKey | JGUWJHNCDCMKJI-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|