C12H11BrFN3O — CID 136955963
5-bromo-4-[2-(2-fluorophenyl)ethylamino]-1H-pyrimidin-6-one (PubChem CID 136955963) has the molecular formula C12H11BrFN3O and a molecular weight of 312.14 g/mol. Its IUPAC name is 5-bromo-4-[2-(2-fluorophenyl)ethylamino]-1H-pyrimidin-6-one.
| Compound Name | 5-bromo-4-[2-(2-fluorophenyl)ethylamino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136955963 |
| Molecular Formula | C12H11BrFN3O |
| Molecular Weight | 312.14 g/mol |
| Exact Mass | 311.01 |
| IUPAC Name | 5-bromo-4-[2-(2-fluorophenyl)ethylamino]-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]cnc(NCCc2ccccc2F)c1Br |
| InChI | InChI=1S/C12H11BrFN3O/c13-10-11(16-7-17-12(10)18)15-6-5-8-3-1-2-4-9(8)14/h1-4,7H,5-6H2,(H2,15,16,17,18) |
| InChIKey | BILYJELPSAFXQW-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.14 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |