C8H10BrN3O3S — CID 136955979
5-bromo-4-[(1,1-dioxothiolan-3-yl)amino]-1H-pyrimidin-6-one (PubChem CID 136955979) has the molecular formula C8H10BrN3O3S and a molecular weight of 308.16 g/mol. Its IUPAC name is 5-bromo-4-[(1,1-dioxothiolan-3-yl)amino]-1H-pyrimidin-6-one.
| Compound Name | 5-bromo-4-[(1,1-dioxothiolan-3-yl)amino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136955979 |
| Molecular Formula | C8H10BrN3O3S |
| Molecular Weight | 308.16 g/mol |
| Exact Mass | 306.96 |
| IUPAC Name | 5-bromo-4-[(1,1-dioxothiolan-3-yl)amino]-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]cnc(NC2CCS(=O)(=O)C2)c1Br |
| InChI | InChI=1S/C8H10BrN3O3S/c9-6-7(10-4-11-8(6)13)12-5-1-2-16(14,15)3-5/h4-5H,1-3H2,(H2,10,11,12,13) |
| InChIKey | CBFAMIPMXPWGJZ-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.16 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |